C9H12N2O — CID 130738790
2-ethylidene-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-one (PubChem CID 130738790) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-ethylidene-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-one.
| Compound Name | 2-ethylidene-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-one |
|---|---|
| PubChem CID | 130738790 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-ethylidene-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-one |
| SMILES | CC=C1N=C2CCCCN2C1=O |
| InChI | InChI=1S/C9H12N2O/c1-2-7-9(12)11-6-4-3-5-8(11)10-7/h2H,3-6H2,1H3 |
| InChIKey | WZQPVHRNIAJJIZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|