About 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole
5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole (PubChem CID 130738892) has the molecular formula C4H4Cl2N4S
and a molecular weight of 211.08 g/mol. Its IUPAC name is 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole.
Molecular Properties
| Compound Name | 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole |
| PubChem CID | 130738892 |
| Molecular Formula | C4H4Cl2N4S |
| Molecular Weight | 211.08 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole |
| SMILES | N/N=N/Cc1snc(Cl)c1Cl |
| InChI | InChI=1S/C4H4Cl2N4S/c5-3-2(1-8-10-7)11-9-4(3)6/h1H2,(H2,7,8) |
| InChIKey | WOXNXHCGZJBBMC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.08 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole?
The IUPAC name of 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole (CID 130738892) is 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole.
What is the SMILES notation for 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole?
The canonical SMILES for 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole is N/N=N/Cc1snc(Cl)c1Cl.
What is the InChIKey of 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole?
The InChIKey is WOXNXHCGZJBBMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4Cl2N4S/c5-3-2(1-8-10-7)11-9-4(3)6/h1H2,(H2,7,8).
What are the key properties of 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole?
5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole has a molecular weight of 211.08 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(aminodiazenyl)methyl]-3,4-dichloro-1,2-thiazole is sourced from PubChem (CID 130738892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).