About (2-oxoazepan-3-yl) acetate
(2-oxoazepan-3-yl) acetate (PubChem CID 130739746) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is (2-oxoazepan-3-yl) acetate.
Molecular Properties
| Compound Name | (2-oxoazepan-3-yl) acetate |
| PubChem CID | 130739746 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2-oxoazepan-3-yl) acetate |
| SMILES | CC(=O)OC1CCCCNC1=O |
| InChI | InChI=1S/C8H13NO3/c1-6(10)12-7-4-2-3-5-9-8(7)11/h7H,2-5H2,1H3,(H,9,11) |
| InChIKey | FYCCVMRIBDCEHW-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxoazepan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoazepan-3-yl) acetate?
The IUPAC name of (2-oxoazepan-3-yl) acetate (CID 130739746) is (2-oxoazepan-3-yl) acetate.
What is the SMILES notation for (2-oxoazepan-3-yl) acetate?
The canonical SMILES for (2-oxoazepan-3-yl) acetate is CC(=O)OC1CCCCNC1=O.
What is the InChIKey of (2-oxoazepan-3-yl) acetate?
The InChIKey is FYCCVMRIBDCEHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-6(10)12-7-4-2-3-5-9-8(7)11/h7H,2-5H2,1H3,(H,9,11).
What are the key properties of (2-oxoazepan-3-yl) acetate?
(2-oxoazepan-3-yl) acetate has a molecular weight of 171.20 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazepan-3-yl) acetate is sourced from PubChem (CID 130739746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).