About 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine
5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine (PubChem CID 130739929) has the molecular formula C8H12BrF2N
and a molecular weight of 240.09 g/mol. Its IUPAC name is 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 130739929 |
| Molecular Formula | C8H12BrF2N |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C(Br)CN(CC(F)F)CC1 |
| InChI | InChI=1S/C8H12BrF2N/c1-6-2-3-12(4-7(6)9)5-8(10)11/h8H,2-5H2,1H3 |
| InChIKey | FWWCAMWCLHGEFY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine (CID 130739929) is 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine is CC1=C(Br)CN(CC(F)F)CC1.
What is the InChIKey of 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is FWWCAMWCLHGEFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrF2N/c1-6-2-3-12(4-7(6)9)5-8(10)11/h8H,2-5H2,1H3.
What are the key properties of 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine?
5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 240.09 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 130739929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).