C10H15FN2 — CID 130741004
(1R)-1-(2-fluoro-4-pyridinyl)-2,2-dimethylpropan-1-amine (PubChem CID 130741004) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is (1R)-1-(2-fluoro-4-pyridinyl)-2,2-dimethylpropan-1-amine.
| Compound Name | (1R)-1-(2-fluoro-4-pyridinyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 130741004 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (1R)-1-(2-fluoro-4-pyridinyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)[C@@H](N)c1ccnc(F)c1 |
| InChI | InChI=1S/C10H15FN2/c1-10(2,3)9(12)7-4-5-13-8(11)6-7/h4-6,9H,12H2,1-3H3/t9-/m0/s1 |
| InChIKey | BVHLCTJJBXCRLD-VIFPVBQESA-N |
| XLogP | 2.27 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|