C10H13NO — CID 130741067
[(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol (PubChem CID 130741067) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol.
| Compound Name | [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol |
|---|---|
| PubChem CID | 130741067 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol |
| SMILES | Cc1ccc2c(c1)[C@H](CO)NC2 |
| InChI | InChI=1S/C10H13NO/c1-7-2-3-8-5-11-10(6-12)9(8)4-7/h2-4,10-12H,5-6H2,1H3/t10-/m0/s1 |
| InChIKey | NDZVXZSTYVXITI-JTQLQIEISA-N |
| XLogP | 1.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |