About [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol
[(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol (PubChem CID 130741067) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol.
Molecular Properties
| Compound Name | [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol |
| PubChem CID | 130741067 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol |
| SMILES | Cc1ccc2c(c1)[C@H](CO)NC2 |
| InChI | InChI=1S/C10H13NO/c1-7-2-3-8-5-11-10(6-12)9(8)4-7/h2-4,10-12H,5-6H2,1H3/t10-/m0/s1 |
| InChIKey | NDZVXZSTYVXITI-JTQLQIEISA-N |
| XLogP | 1.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol?
The IUPAC name of [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol (CID 130741067) is [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol.
What is the SMILES notation for [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol?
The canonical SMILES for [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol is Cc1ccc2c(c1)[C@H](CO)NC2.
What is the InChIKey of [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol?
The InChIKey is NDZVXZSTYVXITI-JTQLQIEISA-N. The full InChI is InChI=1S/C10H13NO/c1-7-2-3-8-5-11-10(6-12)9(8)4-7/h2-4,10-12H,5-6H2,1H3/t10-/m0/s1.
What are the key properties of [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol?
[(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol has a molecular weight of 163.22 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-6-methyl-2,3-dihydro-1H-isoindol-1-yl]methanol is sourced from PubChem (CID 130741067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).