C9H10F2S — CID 130741881
1-(2,2-difluoroethylsulfanyl)-3-methylbenzene (PubChem CID 130741881) has the molecular formula C9H10F2S and a molecular weight of 188.24 g/mol. Its IUPAC name is 1-(2,2-difluoroethylsulfanyl)-3-methylbenzene.
| Compound Name | 1-(2,2-difluoroethylsulfanyl)-3-methylbenzene |
|---|---|
| PubChem CID | 130741881 |
| Molecular Formula | C9H10F2S |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 1-(2,2-difluoroethylsulfanyl)-3-methylbenzene |
| SMILES | Cc1cccc(SCC(F)F)c1 |
| InChI | InChI=1S/C9H10F2S/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5,9H,6H2,1H3 |
| InChIKey | XWJQRBHQIGJWJW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |