2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid

C5H4F2N2O3 — CID 130741991

IUPAC2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid
SMILESO=C(O)Cc1nnc(C(F)F)o1
InChIInChI=1S/C5H4F2N2O3/c6-4(7)5-9-8-2(12-5)1-3(10)11/h4H,1H2,(H,10,11)
InChIKeyBWHADPJRRVEXKK-UHFFFAOYSA-N
MW178.09 g/mol
LogP0.63
Rot. Bonds3

About 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid

2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid (PubChem CID 130741991) has the molecular formula C5H4F2N2O3 and a molecular weight of 178.09 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid
PubChem CID130741991
Molecular FormulaC5H4F2N2O3
Molecular Weight178.09 g/mol
Exact Mass178.02
IUPAC Name2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid
SMILESO=C(O)Cc1nnc(C(F)F)o1
InChIInChI=1S/C5H4F2N2O3/c6-4(7)5-9-8-2(12-5)1-3(10)11/h4H,1H2,(H,10,11)
InChIKeyBWHADPJRRVEXKK-UHFFFAOYSA-N
XLogP0.63
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.09
LogP ≤ 50.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid?
The IUPAC name of 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid (CID 130741991) is 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid.
What is the SMILES notation for 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid?
The canonical SMILES for 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid is O=C(O)Cc1nnc(C(F)F)o1.
What is the InChIKey of 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid?
The InChIKey is BWHADPJRRVEXKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F2N2O3/c6-4(7)5-9-8-2(12-5)1-3(10)11/h4H,1H2,(H,10,11).
What are the key properties of 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid?
2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid has a molecular weight of 178.09 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]acetic acid is sourced from PubChem (CID 130741991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).