About N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine
N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine (PubChem CID 130742031) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine |
| PubChem CID | 130742031 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine |
| SMILES | CN(C)c1noc(C2(C)CC2)n1 |
| InChI | InChI=1S/C8H13N3O/c1-8(4-5-8)6-9-7(10-12-6)11(2)3/h4-5H2,1-3H3 |
| InChIKey | XGFUMYWTEYAWNC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine?
The IUPAC name of N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine (CID 130742031) is N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine?
The canonical SMILES for N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine is CN(C)c1noc(C2(C)CC2)n1.
What is the InChIKey of N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine?
The InChIKey is XGFUMYWTEYAWNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-8(4-5-8)6-9-7(10-12-6)11(2)3/h4-5H2,1-3H3.
What are the key properties of N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine?
N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine has a molecular weight of 167.21 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-5-(1-methylcyclopropyl)-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 130742031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).