C6H9N3O2S — CID 130742356
(3S,4R)-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3,4-diol (PubChem CID 130742356) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is (3S,4R)-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 130742356 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | (3S,4R)-1-(1,2,4-thiadiazol-5-yl)pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(c2ncns2)C[C@@H]1O |
| InChI | InChI=1S/C6H9N3O2S/c10-4-1-9(2-5(4)11)6-7-3-8-12-6/h3-5,10-11H,1-2H2/t4-,5+ |
| InChIKey | OBSSYMVMQBODMU-SYDPRGILSA-N |
| XLogP | -0.92 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |