C10H18O2 — CID 130742583
(1S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 130742583) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (1S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 130742583 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (1S)-4-(hydroxymethyl)-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CC1=C(CO)C(C)(C)C[C@@H](O)C1 |
| InChI | InChI=1S/C10H18O2/c1-7-4-8(12)5-10(2,3)9(7)6-11/h8,11-12H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | JQMCHZCJLKMHFF-QMMMGPOBSA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|