C9H7N3O — CID 130744039
2-(7-oxo-1H-pyrrolo[2,3-c]pyridin-6-yl)acetonitrile (PubChem CID 130744039) has the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-(7-oxo-1H-pyrrolo[2,3-c]pyridin-6-yl)acetonitrile.
| Compound Name | 2-(7-oxo-1H-pyrrolo[2,3-c]pyridin-6-yl)acetonitrile |
|---|---|
| PubChem CID | 130744039 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 2-(7-oxo-1H-pyrrolo[2,3-c]pyridin-6-yl)acetonitrile |
| SMILES | N#CCn1ccc2cc[nH]c2c1=O |
| InChI | InChI=1S/C9H7N3O/c10-3-6-12-5-2-7-1-4-11-8(7)9(12)13/h1-2,4-5,11H,6H2 |
| InChIKey | VIIFILGRXBJMRW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |