C14H20N2O2S — CID 13074428
N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methanesulfonamide (PubChem CID 13074428) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methanesulfonamide.
| Compound Name | N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 13074428 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[(2R,11bS)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CCN2CCc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C14H20N2O2S/c1-19(17,18)15-12-7-9-16-8-6-11-4-2-3-5-13(11)14(16)10-12/h2-5,12,14-15H,6-10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | MLXRMNXLSJDKMK-OCCSQVGLSA-N |
| XLogP | 1.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |