About 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine
3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine (PubChem CID 13074569) has the molecular formula C19H19ClN2O
and a molecular weight of 326.83 g/mol. Its IUPAC name is 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine |
| PubChem CID | 13074569 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine |
| SMILES | CN1CCC(C2=Nc3cc(Cl)ccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C19H19ClN2O/c1-22-10-8-13(9-11-22)19-15-4-2-3-5-17(15)23-18-7-6-14(20)12-16(18)21-19/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | JGIWJHKDXSZETF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine?
The IUPAC name of 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine (CID 13074569) is 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine.
What is the SMILES notation for 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine?
The canonical SMILES for 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine is CN1CCC(C2=Nc3cc(Cl)ccc3Oc3ccccc32)CC1.
What is the InChIKey of 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine?
The InChIKey is JGIWJHKDXSZETF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2O/c1-22-10-8-13(9-11-22)19-15-4-2-3-5-17(15)23-18-7-6-14(20)12-16(18)21-19/h2-7,12-13H,8-11H2,1H3.
What are the key properties of 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine?
3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine has a molecular weight of 326.83 g/mol, XLogP of 4.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(1-methylpiperidin-4-yl)benzo[b][1,4]benzoxazepine is sourced from PubChem (CID 13074569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).