C16H10Cl2N6S2 — CID 13074629
5-(4-chlorophenyl)-3-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole (PubChem CID 13074629) has the molecular formula C16H10Cl2N6S2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-(4-chlorophenyl)-3-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 13074629 |
| Molecular Formula | C16H10Cl2N6S2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]disulfanyl]-1H-1,2,4-triazole |
| SMILES | Clc1ccc(-c2nc(SSc3n[nH]c(-c4ccc(Cl)cc4)n3)n[nH]2)cc1 |
| InChI | InChI=1S/C16H10Cl2N6S2/c17-11-5-1-9(2-6-11)13-19-15(23-21-13)25-26-16-20-14(22-24-16)10-3-7-12(18)8-4-10/h1-8H,(H,19,21,23)(H,20,22,24) |
| InChIKey | XECPKDVLOKQQQZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|