About 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone
2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone (PubChem CID 130747195) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone.
Molecular Properties
| Compound Name | 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone |
| PubChem CID | 130747195 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone |
| SMILES | CC1(C)CCN1C(=O)C1=CCCO1 |
| InChI | InChI=1S/C10H15NO2/c1-10(2)5-6-11(10)9(12)8-4-3-7-13-8/h4H,3,5-7H2,1-2H3 |
| InChIKey | DPYQOTIZESURFR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone?
The IUPAC name of 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone (CID 130747195) is 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone.
What is the SMILES notation for 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone?
The canonical SMILES for 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone is CC1(C)CCN1C(=O)C1=CCCO1.
What is the InChIKey of 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone?
The InChIKey is DPYQOTIZESURFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-10(2)5-6-11(10)9(12)8-4-3-7-13-8/h4H,3,5-7H2,1-2H3.
What are the key properties of 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone?
2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone has a molecular weight of 181.23 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuran-5-yl-(2,2-dimethylazetidin-1-yl)methanone is sourced from PubChem (CID 130747195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).