About N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine
N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine (PubChem CID 130748483) has the molecular formula C9H11IN2S
and a molecular weight of 306.17 g/mol. Its IUPAC name is N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine.
Molecular Properties
| Compound Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine |
| PubChem CID | 130748483 |
| Molecular Formula | C9H11IN2S |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine |
| SMILES | C#CC(C)N(C)Cc1ncc(I)s1 |
| InChI | InChI=1S/C9H11IN2S/c1-4-7(2)12(3)6-9-11-5-8(10)13-9/h1,5,7H,6H2,2-3H3 |
| InChIKey | QIOJSRPFXDAMFC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine?
The IUPAC name of N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine (CID 130748483) is N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine.
What is the SMILES notation for N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine?
The canonical SMILES for N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine is C#CC(C)N(C)Cc1ncc(I)s1.
What is the InChIKey of N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine?
The InChIKey is QIOJSRPFXDAMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11IN2S/c1-4-7(2)12(3)6-9-11-5-8(10)13-9/h1,5,7H,6H2,2-3H3.
What are the key properties of N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine?
N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine has a molecular weight of 306.17 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-iodo-1,3-thiazol-2-yl)methyl]-N-methylbut-3-yn-2-amine is sourced from PubChem (CID 130748483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).