About 6H-quinoline-5-thione
6H-quinoline-5-thione (PubChem CID 130750241) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is 6H-quinoline-5-thione.
Molecular Properties
| Compound Name | 6H-quinoline-5-thione |
| PubChem CID | 130750241 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 6H-quinoline-5-thione |
| SMILES | S=C1CC=Cc2ncccc21 |
| InChI | InChI=1S/C9H7NS/c11-9-5-1-4-8-7(9)3-2-6-10-8/h1-4,6H,5H2 |
| InChIKey | FTZOJNNERFXIAY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6H-quinoline-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-quinoline-5-thione?
The IUPAC name of 6H-quinoline-5-thione (CID 130750241) is 6H-quinoline-5-thione.
What is the SMILES notation for 6H-quinoline-5-thione?
The canonical SMILES for 6H-quinoline-5-thione is S=C1CC=Cc2ncccc21.
What is the InChIKey of 6H-quinoline-5-thione?
The InChIKey is FTZOJNNERFXIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS/c11-9-5-1-4-8-7(9)3-2-6-10-8/h1-4,6H,5H2.
What are the key properties of 6H-quinoline-5-thione?
6H-quinoline-5-thione has a molecular weight of 161.23 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-quinoline-5-thione is sourced from PubChem (CID 130750241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).