About 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide
2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 130751881) has the molecular formula C8H11FN2OS
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 130751881 |
| Molecular Formula | C8H11FN2OS |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(C(F)C(=O)N(C)C)n1 |
| InChI | InChI=1S/C8H11FN2OS/c1-5-4-13-7(10-5)6(9)8(12)11(2)3/h4,6H,1-3H3 |
| InChIKey | MSTHJGZUHGKQRW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide (CID 130751881) is 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide is Cc1csc(C(F)C(=O)N(C)C)n1.
What is the InChIKey of 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is MSTHJGZUHGKQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2OS/c1-5-4-13-7(10-5)6(9)8(12)11(2)3/h4,6H,1-3H3.
What are the key properties of 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide?
2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 202.25 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,N-dimethyl-2-(4-methyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 130751881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).