C11H19NO2 — CID 130754571
(3aS,5S,7aR)-5-tert-butyl-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-2-one (PubChem CID 130754571) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (3aS,5S,7aR)-5-tert-butyl-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-2-one.
| Compound Name | (3aS,5S,7aR)-5-tert-butyl-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 130754571 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (3aS,5S,7aR)-5-tert-butyl-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-2-one |
| SMILES | CC(C)(C)[C@H]1CC[C@H]2OC(=O)N[C@H]2C1 |
| InChI | InChI=1S/C11H19NO2/c1-11(2,3)7-4-5-9-8(6-7)12-10(13)14-9/h7-9H,4-6H2,1-3H3,(H,12,13)/t7-,8-,9+/m0/s1 |
| InChIKey | BJQIJABTHJFPFF-XHNCKOQMSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |