About 4-chloro-3-methyl-1,3-benzoxazol-2-one
4-chloro-3-methyl-1,3-benzoxazol-2-one (PubChem CID 13075595) has the molecular formula C8H6ClNO2
and a molecular weight of 183.59 g/mol. Its IUPAC name is 4-chloro-3-methyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 4-chloro-3-methyl-1,3-benzoxazol-2-one |
| PubChem CID | 13075595 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 4-chloro-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cccc(Cl)c21 |
| InChI | InChI=1S/C8H6ClNO2/c1-10-7-5(9)3-2-4-6(7)12-8(10)11/h2-4H,1H3 |
| InChIKey | SOFMTSDPRKYZAK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-3-methyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-methyl-1,3-benzoxazol-2-one?
The IUPAC name of 4-chloro-3-methyl-1,3-benzoxazol-2-one (CID 13075595) is 4-chloro-3-methyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 4-chloro-3-methyl-1,3-benzoxazol-2-one?
The canonical SMILES for 4-chloro-3-methyl-1,3-benzoxazol-2-one is Cn1c(=O)oc2cccc(Cl)c21.
What is the InChIKey of 4-chloro-3-methyl-1,3-benzoxazol-2-one?
The InChIKey is SOFMTSDPRKYZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO2/c1-10-7-5(9)3-2-4-6(7)12-8(10)11/h2-4H,1H3.
What are the key properties of 4-chloro-3-methyl-1,3-benzoxazol-2-one?
4-chloro-3-methyl-1,3-benzoxazol-2-one has a molecular weight of 183.59 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-methyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 13075595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).