C9H11ClO — CID 130756322
(1R,2S,3S,4R,5S)-3-chloro-5-ethynylbicyclo[2.2.1]heptan-2-ol (PubChem CID 130756322) has the molecular formula C9H11ClO and a molecular weight of 170.64 g/mol. Its IUPAC name is (1R,2S,3S,4R,5S)-3-chloro-5-ethynylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2S,3S,4R,5S)-3-chloro-5-ethynylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 130756322 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (1R,2S,3S,4R,5S)-3-chloro-5-ethynylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C#C[C@H]1C[C@@H]2C[C@H]1[C@H](Cl)[C@H]2O |
| InChI | InChI=1S/C9H11ClO/c1-2-5-3-6-4-7(5)8(10)9(6)11/h1,5-9,11H,3-4H2/t5-,6+,7+,8-,9-/m0/s1 |
| InChIKey | MCVINCNVTPENLJ-ABRLLLAPSA-N |
| XLogP | 1.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|