C7H12O2S — CID 130756875
(1S)-1-[(3S)-3,6-dihydro-2H-thiopyran-3-yl]ethane-1,2-diol (PubChem CID 130756875) has the molecular formula C7H12O2S and a molecular weight of 160.24 g/mol. Its IUPAC name is (1S)-1-[(3S)-3,6-dihydro-2H-thiopyran-3-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(3S)-3,6-dihydro-2H-thiopyran-3-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 130756875 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (1S)-1-[(3S)-3,6-dihydro-2H-thiopyran-3-yl]ethane-1,2-diol |
| SMILES | OC[C@@H](O)[C@@H]1C=CCSC1 |
| InChI | InChI=1S/C7H12O2S/c8-4-7(9)6-2-1-3-10-5-6/h1-2,6-9H,3-5H2/t6-,7-/m1/s1 |
| InChIKey | BSTTWFQNHLIQPM-RNFRBKRXSA-N |
| XLogP | 0.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|