C7H12F3NO2 — CID 130757273
(3S,4R)-4-[methyl(2,2,2-trifluoroethyl)amino]oxolan-3-ol (PubChem CID 130757273) has the molecular formula C7H12F3NO2 and a molecular weight of 199.17 g/mol. Its IUPAC name is (3S,4R)-4-[methyl(2,2,2-trifluoroethyl)amino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[methyl(2,2,2-trifluoroethyl)amino]oxolan-3-ol |
|---|---|
| PubChem CID | 130757273 |
| Molecular Formula | C7H12F3NO2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (3S,4R)-4-[methyl(2,2,2-trifluoroethyl)amino]oxolan-3-ol |
| SMILES | CN(CC(F)(F)F)[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C7H12F3NO2/c1-11(4-7(8,9)10)5-2-13-3-6(5)12/h5-6,12H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | JFXXSWPEBMIYKF-PHDIDXHHSA-N |
| XLogP | 0.24 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |