About [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone
[2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 130757854) has the molecular formula C9H9N3OS2
and a molecular weight of 239.32 g/mol. Its IUPAC name is [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 130757854 |
| Molecular Formula | C9H9N3OS2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)c2csc(CN)n2)cs1 |
| InChI | InChI=1S/C9H9N3OS2/c1-5-11-6(3-14-5)9(13)7-4-15-8(2-10)12-7/h3-4H,2,10H2,1H3 |
| InChIKey | NSFGTDVDCZRVBQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone?
The IUPAC name of [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (CID 130757854) is [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone is Cc1nc(C(=O)c2csc(CN)n2)cs1.
What is the InChIKey of [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone?
The InChIKey is NSFGTDVDCZRVBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS2/c1-5-11-6(3-14-5)9(13)7-4-15-8(2-10)12-7/h3-4H,2,10H2,1H3.
What are the key properties of [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone?
[2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone has a molecular weight of 239.32 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)-1,3-thiazol-4-yl]-(2-methyl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 130757854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).