C6H10O4 — CID 130760786
(2S,3R,4S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 130760786) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (2S,3R,4S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol.
| Compound Name | (2S,3R,4S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 130760786 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (2S,3R,4S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | CO[C@H]1OC=C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10O4/c1-9-6-5(8)4(7)2-3-10-6/h2-8H,1H3/t4-,5+,6-/m0/s1 |
| InChIKey | RRVMTPHITJSECJ-JKUQZMGJSA-N |
| XLogP | -0.78 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |