C6H8O3 — CID 130761639
(3S,3aR,6aR)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-ol (PubChem CID 130761639) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is (3S,3aR,6aR)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3S,3aR,6aR)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 130761639 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | (3S,3aR,6aR)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@H]1CO[C@@H]2C=CO[C@H]12 |
| InChI | InChI=1S/C6H8O3/c7-4-3-9-5-1-2-8-6(4)5/h1-2,4-7H,3H2/t4-,5+,6+/m0/s1 |
| InChIKey | RMWKNPUEMIQVLB-KVQBGUIXSA-N |
| XLogP | -0.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |