C37H39F3N2S — CID 13076182
1-[4,4-bis(4-fluorophenyl)butyl]-4-(9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine (PubChem CID 13076182) has the molecular formula C37H39F3N2S and a molecular weight of 600.79 g/mol. Its IUPAC name is 1-[4,4-bis(4-fluorophenyl)butyl]-4-(9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine.
| Compound Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-(9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine |
|---|---|
| PubChem CID | 13076182 |
| Molecular Formula | C37H39F3N2S |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 1-[4,4-bis(4-fluorophenyl)butyl]-4-(9-fluoro-3-propan-2-yl-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazine |
| SMILES | CC(C)c1ccc2c(c1)C(N1CCN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC1)Cc1ccc(F)cc1S2 |
| InChI | InChI=1S/C37H39F3N2S/c1-25(2)28-10-16-36-34(22-28)35(23-29-9-15-32(40)24-37(29)43-36)42-20-18-41(19-21-42)17-3-4-33(26-5-11-30(38)12-6-26)27-7-13-31(39)14-8-27/h5-16,22,24-25,33,35H,3-4,17-21,23H2,1-2H3 |
| InChIKey | BHZDOWJCHWZUHW-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|