C10H20ClN3O — CID 130762786
[4-(aminomethyl)-2-methylpyrrolidin-1-yl]-(azetidin-3-yl)methanone;hydrochloride (PubChem CID 130762786) has the molecular formula C10H20ClN3O and a molecular weight of 233.74 g/mol. Its IUPAC name is [4-(aminomethyl)-2-methylpyrrolidin-1-yl]-(azetidin-3-yl)methanone;hydrochloride.
| Compound Name | [4-(aminomethyl)-2-methylpyrrolidin-1-yl]-(azetidin-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 130762786 |
| Molecular Formula | C10H20ClN3O |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | [4-(aminomethyl)-2-methylpyrrolidin-1-yl]-(azetidin-3-yl)methanone;hydrochloride |
| SMILES | CC1CC(CN)CN1C(=O)C1CNC1.Cl |
| InChI | InChI=1S/C10H19N3O.ClH/c1-7-2-8(3-11)6-13(7)10(14)9-4-12-5-9;/h7-9,12H,2-6,11H2,1H3;1H |
| InChIKey | MFYGQFKRCQOBGC-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |