About N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine
N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine (PubChem CID 130763267) has the molecular formula C10H17N3S
and a molecular weight of 211.33 g/mol. Its IUPAC name is N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine.
Molecular Properties
| Compound Name | N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine |
| PubChem CID | 130763267 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine |
| SMILES | Cc1cnc(C(C)(C)NC2CNC2)s1 |
| InChI | InChI=1S/C10H17N3S/c1-7-4-12-9(14-7)10(2,3)13-8-5-11-6-8/h4,8,11,13H,5-6H2,1-3H3 |
| InChIKey | VNNNVDOZLHPNQX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine?
The IUPAC name of N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine (CID 130763267) is N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine.
What is the SMILES notation for N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine?
The canonical SMILES for N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine is Cc1cnc(C(C)(C)NC2CNC2)s1.
What is the InChIKey of N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine?
The InChIKey is VNNNVDOZLHPNQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3S/c1-7-4-12-9(14-7)10(2,3)13-8-5-11-6-8/h4,8,11,13H,5-6H2,1-3H3.
What are the key properties of N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine?
N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine has a molecular weight of 211.33 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]azetidin-3-amine is sourced from PubChem (CID 130763267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).