C11H18O3 — CID 130763756
(1'S,2'S,3'aS,6'aR)-1'-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-ol (PubChem CID 130763756) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (1'S,2'S,3'aS,6'aR)-1'-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-ol.
| Compound Name | (1'S,2'S,3'aS,6'aR)-1'-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-ol |
|---|---|
| PubChem CID | 130763756 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (1'S,2'S,3'aS,6'aR)-1'-methylspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-ol |
| SMILES | C[C@H]1[C@@H]2CC3(C[C@@H]2C[C@@H]1O)OCCO3 |
| InChI | InChI=1S/C11H18O3/c1-7-9-6-11(13-2-3-14-11)5-8(9)4-10(7)12/h7-10,12H,2-6H2,1H3/t7-,8-,9-,10-/m0/s1 |
| InChIKey | ICBFNEWCWKQFMZ-XKNYDFJKSA-N |
| XLogP | 1.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |