About methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate
methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 130763888) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate |
| PubChem CID | 130763888 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate |
| SMILES | COC(=O)[C@H]1N=C(C)C[C@@H]1O |
| InChI | InChI=1S/C7H11NO3/c1-4-3-5(9)6(8-4)7(10)11-2/h5-6,9H,3H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | LUMQUBMJOGBAIO-WDSKDSINSA-N |
| XLogP | -0.25 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate?
The IUPAC name of methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate (CID 130763888) is methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate.
What is the SMILES notation for methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate?
The canonical SMILES for methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate is COC(=O)[C@H]1N=C(C)C[C@@H]1O.
What is the InChIKey of methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate?
The InChIKey is LUMQUBMJOGBAIO-WDSKDSINSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4-3-5(9)6(8-4)7(10)11-2/h5-6,9H,3H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate?
methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate has a molecular weight of 157.17 g/mol, XLogP of -0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3S)-3-hydroxy-5-methyl-3,4-dihydro-2H-pyrrole-2-carboxylate is sourced from PubChem (CID 130763888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).