About benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate
benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate (PubChem CID 13076417) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate |
| PubChem CID | 13076417 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate |
| SMILES | COc1ccc2c(C3CCN(C(=O)OCc4ccccc4)CC3)noc2c1 |
| InChI | InChI=1S/C21H22N2O4/c1-25-17-7-8-18-19(13-17)27-22-20(18)16-9-11-23(12-10-16)21(24)26-14-15-5-3-2-4-6-15/h2-8,13,16H,9-12,14H2,1H3 |
| InChIKey | NHMMJHHJXWPHHV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate?
The IUPAC name of benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate (CID 13076417) is benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate.
What is the SMILES notation for benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate?
The canonical SMILES for benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate is COc1ccc2c(C3CCN(C(=O)OCc4ccccc4)CC3)noc2c1.
What is the InChIKey of benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate?
The InChIKey is NHMMJHHJXWPHHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4/c1-25-17-7-8-18-19(13-17)27-22-20(18)16-9-11-23(12-10-16)21(24)26-14-15-5-3-2-4-6-15/h2-8,13,16H,9-12,14H2,1H3.
What are the key properties of benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate?
benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate has a molecular weight of 366.42 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(6-methoxy-1,2-benzoxazol-3-yl)piperidine-1-carboxylate is sourced from PubChem (CID 13076417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).