About 7-chloro-2H-2,6-naphthyridin-1-one
7-chloro-2H-2,6-naphthyridin-1-one (PubChem CID 130764227) has the molecular formula C8H5ClN2O
and a molecular weight of 180.59 g/mol. Its IUPAC name is 7-chloro-2H-2,6-naphthyridin-1-one.
Molecular Properties
| Compound Name | 7-chloro-2H-2,6-naphthyridin-1-one |
| PubChem CID | 130764227 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 7-chloro-2H-2,6-naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2cnc(Cl)cc12 |
| InChI | InChI=1S/C8H5ClN2O/c9-7-3-6-5(4-11-7)1-2-10-8(6)12/h1-4H,(H,10,12) |
| InChIKey | LWBOYUZYAWEGJL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2H-2,6-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2H-2,6-naphthyridin-1-one?
The IUPAC name of 7-chloro-2H-2,6-naphthyridin-1-one (CID 130764227) is 7-chloro-2H-2,6-naphthyridin-1-one.
What is the SMILES notation for 7-chloro-2H-2,6-naphthyridin-1-one?
The canonical SMILES for 7-chloro-2H-2,6-naphthyridin-1-one is O=c1[nH]ccc2cnc(Cl)cc12.
What is the InChIKey of 7-chloro-2H-2,6-naphthyridin-1-one?
The InChIKey is LWBOYUZYAWEGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O/c9-7-3-6-5(4-11-7)1-2-10-8(6)12/h1-4H,(H,10,12).
What are the key properties of 7-chloro-2H-2,6-naphthyridin-1-one?
7-chloro-2H-2,6-naphthyridin-1-one has a molecular weight of 180.59 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2H-2,6-naphthyridin-1-one is sourced from PubChem (CID 130764227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).