C10H9ClF3N3O — CID 130764955
1-(3-chloro-5,6,8,9-tetrahydropyrazino[2,3-d]azepin-7-yl)-2,2,2-trifluoroethanone (PubChem CID 130764955) has the molecular formula C10H9ClF3N3O and a molecular weight of 279.65 g/mol. Its IUPAC name is 1-(3-chloro-5,6,8,9-tetrahydropyrazino[2,3-d]azepin-7-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3-chloro-5,6,8,9-tetrahydropyrazino[2,3-d]azepin-7-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 130764955 |
| Molecular Formula | C10H9ClF3N3O |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 1-(3-chloro-5,6,8,9-tetrahydropyrazino[2,3-d]azepin-7-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCc2ncc(Cl)nc2CC1)C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3N3O/c11-8-5-15-6-1-3-17(4-2-7(6)16-8)9(18)10(12,13)14/h5H,1-4H2 |
| InChIKey | BXGGQNXFXLCRBH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |