About (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine
(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine (PubChem CID 130765187) has the molecular formula C7H11F2NO
and a molecular weight of 163.17 g/mol. Its IUPAC name is (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine.
Molecular Properties
| Compound Name | (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine |
| PubChem CID | 130765187 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine |
| SMILES | NC[C@@H](C(F)F)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C7H11F2NO/c8-7(9)5(4-10)6-2-1-3-11-6/h1-2,5-7H,3-4,10H2/t5-,6+/m1/s1 |
| InChIKey | GKNDOXVUJCHNNU-RITPCOANSA-N |
| XLogP | 0.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine?
The IUPAC name of (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine (CID 130765187) is (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine.
What is the SMILES notation for (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine?
The canonical SMILES for (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine is NC[C@@H](C(F)F)[C@@H]1C=CCO1.
What is the InChIKey of (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine?
The InChIKey is GKNDOXVUJCHNNU-RITPCOANSA-N. The full InChI is InChI=1S/C7H11F2NO/c8-7(9)5(4-10)6-2-1-3-11-6/h1-2,5-7H,3-4,10H2/t5-,6+/m1/s1.
What are the key properties of (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine?
(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine has a molecular weight of 163.17 g/mol, XLogP of 0.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3,3-difluoropropan-1-amine is sourced from PubChem (CID 130765187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).