About methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate
methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate (PubChem CID 130766005) has the molecular formula C10H15N3S
and a molecular weight of 209.32 g/mol. Its IUPAC name is methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate.
Molecular Properties
| Compound Name | methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate |
| PubChem CID | 130766005 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate |
| SMILES | CS/C(=N\C#N)N1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C10H15N3S/c1-8-4-5-13(6-9(8)2)10(14-3)12-7-11/h4-6H2,1-3H3/b12-10- |
| InChIKey | DKPFBAUWVJWWED-BENRWUELSA-N |
| XLogP | 2.23 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate?
The IUPAC name of methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate (CID 130766005) is methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate.
What is the SMILES notation for methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate?
The canonical SMILES for methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate is CS/C(=N\C#N)N1CCC(C)=C(C)C1.
What is the InChIKey of methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate?
The InChIKey is DKPFBAUWVJWWED-BENRWUELSA-N. The full InChI is InChI=1S/C10H15N3S/c1-8-4-5-13(6-9(8)2)10(14-3)12-7-11/h4-6H2,1-3H3/b12-10-.
What are the key properties of methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate?
methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate has a molecular weight of 209.32 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-cyano-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboximidothioate is sourced from PubChem (CID 130766005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).