C7H3Br2ClF2 — CID 130766572
2,3-dibromo-1-(chloromethyl)-4,5-difluorobenzene (PubChem CID 130766572) has the molecular formula C7H3Br2ClF2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2,3-dibromo-1-(chloromethyl)-4,5-difluorobenzene.
| Compound Name | 2,3-dibromo-1-(chloromethyl)-4,5-difluorobenzene |
|---|---|
| PubChem CID | 130766572 |
| Molecular Formula | C7H3Br2ClF2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 317.83 |
| IUPAC Name | 2,3-dibromo-1-(chloromethyl)-4,5-difluorobenzene |
| SMILES | Fc1cc(CCl)c(Br)c(Br)c1F |
| InChI | InChI=1S/C7H3Br2ClF2/c8-5-3(2-10)1-4(11)7(12)6(5)9/h1H,2H2 |
| InChIKey | XYDSOHBREDQBLR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|