C16H16F12 — CID 13076704
1,3-bis(1,1,2,3,3,3-hexafluoropropyl)adamantane (PubChem CID 13076704) has the molecular formula C16H16F12 and a molecular weight of 436.28 g/mol. Its IUPAC name is 1,3-bis(1,1,2,3,3,3-hexafluoropropyl)adamantane.
| Compound Name | 1,3-bis(1,1,2,3,3,3-hexafluoropropyl)adamantane |
|---|---|
| PubChem CID | 13076704 |
| Molecular Formula | C16H16F12 |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 1,3-bis(1,1,2,3,3,3-hexafluoropropyl)adamantane |
| SMILES | FC(C(F)(F)F)C(F)(F)C12CC3CC(C1)CC(C(F)(F)C(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C16H16F12/c17-9(15(23,24)25)13(19,20)11-2-7-1-8(4-11)5-12(3-7,6-11)14(21,22)10(18)16(26,27)28/h7-10H,1-6H2 |
| InChIKey | ZYUIZWAFWUWTEQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |