About 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine
2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine (PubChem CID 130769997) has the molecular formula C12H17ClN2
and a molecular weight of 224.73 g/mol. Its IUPAC name is 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine.
Molecular Properties
| Compound Name | 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine |
| PubChem CID | 130769997 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine |
| SMILES | Cc1cccc(N2CC(Cl)C(C)(C)C2)n1 |
| InChI | InChI=1S/C12H17ClN2/c1-9-5-4-6-11(14-9)15-7-10(13)12(2,3)8-15/h4-6,10H,7-8H2,1-3H3 |
| InChIKey | UVCYBVRMOWJRDK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine?
The IUPAC name of 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine (CID 130769997) is 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine.
What is the SMILES notation for 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine?
The canonical SMILES for 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine is Cc1cccc(N2CC(Cl)C(C)(C)C2)n1.
What is the InChIKey of 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine?
The InChIKey is UVCYBVRMOWJRDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN2/c1-9-5-4-6-11(14-9)15-7-10(13)12(2,3)8-15/h4-6,10H,7-8H2,1-3H3.
What are the key properties of 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine?
2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine has a molecular weight of 224.73 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-3,3-dimethylpyrrolidin-1-yl)-6-methylpyridine is sourced from PubChem (CID 130769997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).