About 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol
2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol (PubChem CID 130770273) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol |
| PubChem CID | 130770273 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol |
| SMILES | OCC[C@]12CCCC[C@H]1O2 |
| InChI | InChI=1S/C8H14O2/c9-6-5-8-4-2-1-3-7(8)10-8/h7,9H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | OQJUHKMAUZHXLV-HTQZYQBOSA-N |
| XLogP | 1.08 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol?
The IUPAC name of 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol (CID 130770273) is 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol.
What is the SMILES notation for 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol?
The canonical SMILES for 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol is OCC[C@]12CCCC[C@H]1O2.
What is the InChIKey of 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol?
The InChIKey is OQJUHKMAUZHXLV-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H14O2/c9-6-5-8-4-2-1-3-7(8)10-8/h7,9H,1-6H2/t7-,8-/m1/s1.
What are the key properties of 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol?
2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol has a molecular weight of 142.20 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]ethanol is sourced from PubChem (CID 130770273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).