About methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate
methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate (PubChem CID 1307716) has the molecular formula C19H21NO7
and a molecular weight of 375.38 g/mol. Its IUPAC name is methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate.
Molecular Properties
| Compound Name | methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate |
| PubChem CID | 1307716 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H21NO7/c1-23-14-7-6-11(8-15(14)24-2)18(21)20-13-10-17(26-4)16(25-3)9-12(13)19(22)27-5/h6-10H,1-5H3,(H,20,21) |
| InChIKey | NWKRYCAPFRMKPH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate?
The IUPAC name of methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate (CID 1307716) is methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate.
What is the SMILES notation for methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate?
The canonical SMILES for methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate is COC(=O)c1cc(OC)c(OC)cc1NC(=O)c1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate?
The InChIKey is NWKRYCAPFRMKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO7/c1-23-14-7-6-11(8-15(14)24-2)18(21)20-13-10-17(26-4)16(25-3)9-12(13)19(22)27-5/h6-10H,1-5H3,(H,20,21).
What are the key properties of methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate?
methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate has a molecular weight of 375.38 g/mol, XLogP of 2.76, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,4-dimethoxybenzoyl)amino]-4,5-dimethoxybenzoate is sourced from PubChem (CID 1307716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).