About 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine
6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine (PubChem CID 130774419) has the molecular formula C8H9BrF2N2
and a molecular weight of 251.07 g/mol. Its IUPAC name is 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine |
| PubChem CID | 130774419 |
| Molecular Formula | C8H9BrF2N2 |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine |
| SMILES | CC(Nc1cccc(Br)n1)C(F)F |
| InChI | InChI=1S/C8H9BrF2N2/c1-5(8(10)11)12-7-4-2-3-6(9)13-7/h2-5,8H,1H3,(H,12,13) |
| InChIKey | MOWDHBPVUPHCJT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine?
The IUPAC name of 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine (CID 130774419) is 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine.
What is the SMILES notation for 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine?
The canonical SMILES for 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine is CC(Nc1cccc(Br)n1)C(F)F.
What is the InChIKey of 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine?
The InChIKey is MOWDHBPVUPHCJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrF2N2/c1-5(8(10)11)12-7-4-2-3-6(9)13-7/h2-5,8H,1H3,(H,12,13).
What are the key properties of 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine?
6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine has a molecular weight of 251.07 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-(1,1-difluoropropan-2-yl)pyridin-2-amine is sourced from PubChem (CID 130774419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).