C8H12N4O — CID 130774747
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide (PubChem CID 130774747) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 130774747 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1nnc(C)n1C |
| InChI | InChI=1S/C8H12N4O/c1-4-8(13)9-5-7-11-10-6(2)12(7)3/h4H,1,5H2,2-3H3,(H,9,13) |
| InChIKey | LQSYBLKLXKYVJU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|