About (3R,5R)-3,5-dimethylthiomorpholine
(3R,5R)-3,5-dimethylthiomorpholine (PubChem CID 13077511) has the molecular formula C6H13NS
and a molecular weight of 131.24 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethylthiomorpholine.
Molecular Properties
| Compound Name | (3R,5R)-3,5-dimethylthiomorpholine |
| PubChem CID | 13077511 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | (3R,5R)-3,5-dimethylthiomorpholine |
| SMILES | C[C@@H]1CSC[C@@H](C)N1 |
| InChI | InChI=1S/C6H13NS/c1-5-3-8-4-6(2)7-5/h5-7H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | BFJTWSMISPCLAO-PHDIDXHHSA-N |
| XLogP | 1.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,5R)-3,5-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-3,5-dimethylthiomorpholine?
The IUPAC name of (3R,5R)-3,5-dimethylthiomorpholine (CID 13077511) is (3R,5R)-3,5-dimethylthiomorpholine.
What is the SMILES notation for (3R,5R)-3,5-dimethylthiomorpholine?
The canonical SMILES for (3R,5R)-3,5-dimethylthiomorpholine is C[C@@H]1CSC[C@@H](C)N1.
What is the InChIKey of (3R,5R)-3,5-dimethylthiomorpholine?
The InChIKey is BFJTWSMISPCLAO-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H13NS/c1-5-3-8-4-6(2)7-5/h5-7H,3-4H2,1-2H3/t5-,6-/m1/s1.
What are the key properties of (3R,5R)-3,5-dimethylthiomorpholine?
(3R,5R)-3,5-dimethylthiomorpholine has a molecular weight of 131.24 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-3,5-dimethylthiomorpholine is sourced from PubChem (CID 13077511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).