C13H17N5 — CID 130775574
1-(1-benzylpyrrolidin-3-yl)-1,2,4-triazol-3-amine (PubChem CID 130775574) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-(1-benzylpyrrolidin-3-yl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(1-benzylpyrrolidin-3-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 130775574 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 1-(1-benzylpyrrolidin-3-yl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(C2CCN(Cc3ccccc3)C2)n1 |
| InChI | InChI=1S/C13H17N5/c14-13-15-10-18(16-13)12-6-7-17(9-12)8-11-4-2-1-3-5-11/h1-5,10,12H,6-9H2,(H2,14,16) |
| InChIKey | GYKQWLKTSCMAOJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |