About 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide
5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide (PubChem CID 130778441) has the molecular formula C9H12N2OS
and a molecular weight of 196.27 g/mol. Its IUPAC name is 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide |
| PubChem CID | 130778441 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide |
| SMILES | C=C(C)CNC(=O)c1cc(C)sn1 |
| InChI | InChI=1S/C9H12N2OS/c1-6(2)5-10-9(12)8-4-7(3)13-11-8/h4H,1,5H2,2-3H3,(H,10,12) |
| InChIKey | LPPPSBBPAYBKJA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide?
The IUPAC name of 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide (CID 130778441) is 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide.
What is the SMILES notation for 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide?
The canonical SMILES for 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide is C=C(C)CNC(=O)c1cc(C)sn1.
What is the InChIKey of 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide?
The InChIKey is LPPPSBBPAYBKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-6(2)5-10-9(12)8-4-7(3)13-11-8/h4H,1,5H2,2-3H3,(H,10,12).
What are the key properties of 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide?
5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide has a molecular weight of 196.27 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(2-methylprop-2-enyl)-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 130778441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).