About 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine
1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine (PubChem CID 130778886) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine.
Molecular Properties
| Compound Name | 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine |
| PubChem CID | 130778886 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine |
| SMILES | [H]/N=C1\CCCN1Cc1c(C)cnn1C |
| InChI | InChI=1S/C10H16N4/c1-8-6-12-13(2)9(8)7-14-5-3-4-10(14)11/h6,11H,3-5,7H2,1-2H3/b11-10+ |
| InChIKey | CGHSEPQCJJALGL-ZHACJKMWSA-N |
| XLogP | 1.30 |
| TPSA | 44.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine?
The IUPAC name of 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine (CID 130778886) is 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine.
What is the SMILES notation for 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine?
The canonical SMILES for 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine is [H]/N=C1\CCCN1Cc1c(C)cnn1C.
What is the InChIKey of 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine?
The InChIKey is CGHSEPQCJJALGL-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H16N4/c1-8-6-12-13(2)9(8)7-14-5-3-4-10(14)11/h6,11H,3-5,7H2,1-2H3/b11-10+.
What are the key properties of 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine?
1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine has a molecular weight of 192.27 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,4-dimethylpyrazol-5-yl)methyl]pyrrolidin-2-imine is sourced from PubChem (CID 130778886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).