About disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate
disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate (PubChem CID 13077919) has the molecular formula C9H9Na2O5P
and a molecular weight of 274.12 g/mol. Its IUPAC name is disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate.
Molecular Properties
| Compound Name | disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate |
| PubChem CID | 13077919 |
| Molecular Formula | C9H9Na2O5P |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate |
| SMILES | Cc1cccc(C)c1OP(=O)([O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C9H11O5P.2Na/c1-6-4-3-5-7(2)8(6)14-15(12,13)9(10)11;;/h3-5H,1-2H3,(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | RXRPOMKANXQNMI-UHFFFAOYSA-L |
| XLogP | -5.41 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate?
The IUPAC name of disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate (CID 13077919) is disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate.
What is the SMILES notation for disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate?
The canonical SMILES for disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate is Cc1cccc(C)c1OP(=O)([O-])C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate?
The InChIKey is RXRPOMKANXQNMI-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H11O5P.2Na/c1-6-4-3-5-7(2)8(6)14-15(12,13)9(10)11;;/h3-5H,1-2H3,(H,10,11)(H,12,13);;/q;2*+1/p-2.
What are the key properties of disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate?
disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate has a molecular weight of 274.12 g/mol, XLogP of -5.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[(2,6-dimethylphenoxy)-oxidophosphoryl]formate is sourced from PubChem (CID 13077919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).