About 5-(triazol-1-ylmethyl)-1,2-oxazole
5-(triazol-1-ylmethyl)-1,2-oxazole (PubChem CID 130779651) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 5-(triazol-1-ylmethyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(triazol-1-ylmethyl)-1,2-oxazole |
| PubChem CID | 130779651 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 5-(triazol-1-ylmethyl)-1,2-oxazole |
| SMILES | c1cn(Cc2ccno2)nn1 |
| InChI | InChI=1S/C6H6N4O/c1-2-8-11-6(1)5-10-4-3-7-9-10/h1-4H,5H2 |
| InChIKey | IGNKDDXGVHSGPH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(triazol-1-ylmethyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(triazol-1-ylmethyl)-1,2-oxazole?
The IUPAC name of 5-(triazol-1-ylmethyl)-1,2-oxazole (CID 130779651) is 5-(triazol-1-ylmethyl)-1,2-oxazole.
What is the SMILES notation for 5-(triazol-1-ylmethyl)-1,2-oxazole?
The canonical SMILES for 5-(triazol-1-ylmethyl)-1,2-oxazole is c1cn(Cc2ccno2)nn1.
What is the InChIKey of 5-(triazol-1-ylmethyl)-1,2-oxazole?
The InChIKey is IGNKDDXGVHSGPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c1-2-8-11-6(1)5-10-4-3-7-9-10/h1-4H,5H2.
What are the key properties of 5-(triazol-1-ylmethyl)-1,2-oxazole?
5-(triazol-1-ylmethyl)-1,2-oxazole has a molecular weight of 150.14 g/mol, XLogP of 0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(triazol-1-ylmethyl)-1,2-oxazole is sourced from PubChem (CID 130779651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).